| Identification | |
| Name: | Hydroxylamine,O-[(4-nitrophenyl)methyl]-, hydrochloride (1:1) |
| Synonyms: | Benzyloxyamine,p-nitro-, hydrochloride (6CI,7CI); Hydroxylamine, O-(p-nitrobenzyl)-, monohydrochloride(8CI); Hydroxylamine, O-[(4-nitrophenyl)methyl]-, monohydrochloride (9CI);4-Nitrobenzyloxyamine hydrochloride; O-(4-Nitrobenzyl)hydroxylaminehydrochloride; O-(p-Nitrobenzyl)hydroxylamine hydrochloride;p-Nitrobenzyloxyamine hydrochloride |
| CAS: | 2086-26-2 |
| EINECS: | 218-228-6 |
| Molecular Formula: | C7H8 N2 O3 . Cl H |
| Molecular Weight: | 204.612 |
| InChI: | InChI=1/C7H8N2O3.ClH/c8-12-5-6-1-3-7(4-2-6)9(10)11;/h1-4H,5,8H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 215 °C (dec.)(lit.) |
| Flash Point: | 170.8°C |
| Boiling Point: | 226°C |
| Density: | g/cm3 |
| Refractive index: | 1.588 |
| Specification: | LIGHT YELLOW POWDER Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 170.8°C |
| Sensitive: | Moisture & Light Sensitive |
| Safety Data | |
 |
|
