| Identification | |
| Name: | 2H-Indol-2-one,1,3-dihydro-5-nitro- |
| Synonyms: | 2-Indolinone,5-nitro- (8CI);Oxindole, 5-nitro- (6CI);5-Nitro-1,3-dihydroindol-2-one;5-Nitro-2-indolinone;5-Nitro-2-oxindole;NSC 25199;NSC 99066; |
| CAS: | 20870-79-5 |
| Molecular Formula: | C8H6N2O3 |
| Molecular Weight: | 178.14 |
| InChI: | InChI=1/C8H6N2O3/c11-8-4-5-3-6(10(12)13)1-2-7(5)9-8/h1-3H,4H2,(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.449 g/cm3 |
| Refractive index: | 1.632 |
| Appearance: | Yellow crystals |
| Specification: |
2H-Indol-2-one,1,3-dihydro-5-nitro- , with CAS number of 20870-79-5, can be called 5-Nitro-1,3-dihydroindole-2-one ; 5-nitrooxindole ; 5-nitro-2-oxindole ; 2h-indol-2-one, 1,3-dihydro-5-nitro ; 5-nitrooxindole 96% ; 5-nitroindolin-2-one ; 5-nitrooxidole ; 5-nitro-1,3-dihydro-2h-indol-2-one . |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
