| Identification |
| Name: | Phenol,2-(2-heptyn-1-ylthio)-, 1-acetate |
| Synonyms: | Phenol,2-(2-heptynylthio)-, acetate (9CI); APHS |
| CAS: | 209125-28-0 |
| Molecular Formula: | C15H18 O2 S |
| Molecular Weight: | 264.38 |
| InChI: | InChI=1/C15H18O2S/c1-3-4-5-6-9-12-18-15-11-8-7-10-14(15)17-13(2)16/h7-8,10-11H,3-5,12H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 165.7°C |
| Boiling Point: | 363.3°Cat760mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.554 |
| Flash Point: | 165.7°C |
| Usage: | An O-acetyl, S-alkyl thio ether of 2-thio phenol. It is a potent inhibitor of both COX-1 and COX-2, with IC50 values of 17 and 0.8uM for human recombinant COX-1 and COX-2 respectively. APHS exhibits 20-fold selectivity toward the inhibition of COX |
| Safety Data |
| |
 |
