| Identification |
| Name: | 2,3,4-Trimethoxybenzaldehyde |
| Synonyms: | Benzaldehyde, 2,3,4-trimethoxy-;AI3-36670; |
| CAS: | 2103-57-3 |
| EINECS: | 218-271-0 |
| Molecular Formula: | C10H12O4 |
| Molecular Weight: | 196.2 |
| InChI: | InChI=1/C10H12O4/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Flash Point: | 137.1oC |
| Density: | 1.133g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5547 |
| Solubility: | Slightly soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Conditions to Avoid: Incompatible materials, dust generation, excess HEAT, strong oxidants.
Incompatibilities with Other Materials: Oxidizing agents.
Hazardous Decomposition Products: CARBON monoxide, irritating and toxic fumes and gases, CARBON dioxide.
Hazardous Polymerization: Has not been reported.
|
| HS Code: | 29124900 |
| Flash Point: | 137.1oC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
| |
 |