| Identification |
| Name: | 3-Thiophenemalonic acid |
| Synonyms: | (3-Thienyl)malonic acid; 3-Thienylmalonic acid; 3-Thienylpropanedioic acid; TPA |
| CAS: | 21080-92-2 |
| EINECS: | 244-198-9 |
| Molecular Formula: | C7H6O4S |
| Molecular Weight: | 186.18 |
| InChI: | InChI=1/C7H6O4S/c8-6(9)5(7(10)11)4-1-2-12-3-4/h1-3,5H,(H,8,9)(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Flash Point: | 193.8 oC |
| Boiling Point: | 396.8 oC at 760 mmHg |
| Density: | 1.574 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.627? |
| Solubility: | Very soluble |
| Appearance: | white to off-white crystalline powder |
| Flash Point: | 193.8 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
