| Identification | |
| Name: | 5-Thiazolecarboxamide,2-amino-4-methyl-N-phenyl- |
| Synonyms: | 5-Thiazolecarboxanilide,2-amino-4-methyl- (8CI); 2-Amino-4-methylthiazole-5-carboxanilide; ALF;Amicarthiazol; F 849; Seedvax; Sidvax; Uniroyal F 849 |
| CAS: | 21452-14-2 |
| Molecular Formula: | C11H11 N3 O S |
| Molecular Weight: | 219.30 |
| InChI: | InChI=1/C11H11N3OS/c1-7-9(16-11(12)13-7)10(15)14-8-5-3-2-4-6-8/h2-6H,1H3,(H2,12,13)(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.2°C |
| Boiling Point: | 354.5°Cat760mmHg |
| Density: | 1.375g/cm3 |
| Refractive index: | 1.711 |
| Specification: |
2-Amino-4-methyl-5-carboxanilidothiazole ,its cas register number is 21452-14-2. It also can be called Thiazole, 2-amino-4-methyl-5-phenylcarbamoyl- ; 5-Thiazolecarboxanilide, 2-amino-4-methyl- ; and 5-Thiazolecarboxamide, 2-amino-4-methyl-N-phenyl- . |
| Flash Point: | 168.2°C |
| Safety Data | |
 |
|
