| Identification |
| Name: | Benzonitrile,2,3-difluoro- |
| Synonyms: | 1,2-Difluoro-3-cyanobenzene; |
| CAS: | 21524-39-0 |
| EINECS: | 244-418-3 |
| Molecular Formula: | C7H3F2N |
| Molecular Weight: | 139.1 |
| InChI: | InChI=1/C7H3F2N/c8-6-3-1-2-5(4-10)7(6)9/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3276 |
| Density: | 1.254 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4872-1.4892 |
| Appearance: | colorless to light yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
