| Identification | |
| Name: | 3-Pyridazinecarboxylic acid |
| Synonyms: | 3-Carboxypyridazine;NSC 110335; |
| CAS: | 2164-61-6 |
| Molecular Formula: | C5H4N2O2 |
| Molecular Weight: | 124.0975 |
| InChI: | InChI=1/C5H4N2O2/c8-5(9)4-2-1-3-6-7-4/h1-3H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.403 g/cm3 |
| Refractive index: | 1.578 |
| Specification: |
3-Pyridazinecarboxylicacid , its cas register number is 2164-61-6. It also can be called Pyridazine-3-carboxylic acid . When 3-Pyridazinecarboxylicacid (CAS NO.2164-61-6) is heated to decomposition ,it emits toxic vapors of NOx. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
