| Identification | |
| Name: | Benzenepropanenitrile,3-methoxy-b-oxo- |
| Synonyms: | Acetonitrile,m-anisoyl- (7CI,8CI);3-(3-Methoxyphenyl)-3-oxopropanenitrile;3-(3-Methoxyphenyl)-3-oxopropionitrile;3-Methoxybenzoylacetonitrile;m-Anisoylacetonitrile; |
| CAS: | 21667-60-7 |
| Molecular Formula: | C10H9NO2 |
| Molecular Weight: | 175.184 |
| InChI: | InChI=1/C10H9NO2/c1-13-9-4-2-3-8(7-9)10(12)5-6-11/h2-4,7H,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.131 g/cm3 |
| Refractive index: | 1.525 |
| Specification: |
3-(3-Methoxy-Phenyl)-3-Oxo-Propionitrile (21667-60-7), which also can be called for 3-(3-Methoxyphenyl)-3-Oxopropanenitrile ; 3-(3-Methoxy-Phenyl)-3-Oxo-PropionItrile . 3-(3-Methoxy-Phenyl)-3-Oxo-Propionitrile (21667-60-7) is a kind of irritant chemicals and should be careful when deal with it. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
