| Identification | |
| Name: | Benzene,4-(2-isothiocyanatoethyl)-1,2-dimethoxy- |
| Synonyms: | Isothiocyanicacid, 3,4-dimethoxyphenethyl ester (8CI);3,4-Dimethoxyphenethyl isothiocyanate; |
| CAS: | 21714-25-0 |
| EINECS: | -0 |
| Molecular Formula: | C11H13NO2S |
| Molecular Weight: | 223.28 |
| InChI: | InChI=1/C11H13NO2S/c1-13-10-4-3-9(5-6-12-8-15)7-11(10)14-2/h3-4,7H,5-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 164.9°C |
| Boiling Point: | 349.1°Cat760mmHg |
| Density: | 1.17 |
| Refractive index: | 1.5880 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Flash Point: | 164.9°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
