| Identification |
| Name: | Urea,N,N-dimethyl-N'-[4-(1-methylethyl)phenyl]-, labeled with deuterium (9CI) |
| Synonyms: | isoproturon d6 (dimethyl d6) |
| CAS: | 217487-17-7 |
| Molecular Formula: | C12H12 D6 N2 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H18N2O/c1-9(2)10-5-7-11(8-6-10)13-12(15)14(3)4/h5-9H,1-4H3,(H,13,15)/i3D3,4D3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3077 9/PG 3 |
| Flash Point: | 167.4°C |
| Boiling Point: | 353.2°C at 760 mmHg |
| Density: | 1.081g/cm3 |
| Refractive index: | 1.555 |
| Flash Point: | 167.4°C |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
| |
 |
