| Identification | |
| Name: | Pentachloropyridine |
| Synonyms: | 2,3,4,5,6-Pentachlorpyridine; 2,3,4,5,6- Penta chloro pyridine |
| CAS: | 2176-62-7 |
| EINECS: | 218-535-5 |
| Molecular Formula: | C5Cl5N |
| Molecular Weight: | 251.33 |
| InChI: | InChI=1/C5Cl5N/c6-1-2(7)4(9)11-5(10)3(1)8 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.764 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.601 |
| Solubility: | 8.5 mg/L |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Pentachloropyridine is a commercially important derivative that is utilized in the manufacture of pesticides. In particular, pentachloropyridine is an intermediate for the insecticide, chloropyrifos, and the herbicide, triclopyr. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
