| Identification | |
| Name: | Oxirane,2-chloro-3-methyl-, cis- (9CI) |
| Synonyms: | Propane,1-chloro-1,2-epoxy-, cis- (8CI); cis-1-Chloropropene oxide |
| CAS: | 21947-75-1 |
| Molecular Formula: | C3H5 Cl O |
| Molecular Weight: | 90.51 |
| InChI: | InChI=1/C3H5ClO/c1-2-3(4)5-2/h2-3H,1H3/t2-,3-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 20.1°C |
| Boiling Point: | 91.4°C at 760 mmHg |
| Density: | 1.18g/cm3 |
| Refractive index: | 1.437 |
| Specification: |
cis-1-Chloropropene oxide , its cas register number is 21947-75-1. It also can be called cis-1-Chloro-1,2-epoxypropane ; cis-2-Chloro-3-methyloxirane ; and 1-Chloro-1,2-epoxypropane . Its classification code are Mutation data and Tumor data. |
| Flash Point: | 20.1°C |
| Safety Data | |
 |
|
