| Identification |
| Name: | Hexanoic acid,3-methylbutyl ester |
| Synonyms: | Hexanoicacid, isopentyl ester (7CI,8CI);Isopentyl alcohol, hexanoate (8CI);3-Methylbutyl hexanoate;Isoamyl caproate;Isoamyl hexanoate;Isopentyl hexanoate; |
| CAS: | 2198-61-0 |
| EINECS: | 218-600-8 |
| Molecular Formula: | C11H22O2 |
| Molecular Weight: | 186.29 |
| InChI: | InChI=1/C11H22O2/c1-4-5-6-7-11(12)13-9-8-10(2)3/h10H,4-9H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 250 - 251 |
| Flash Point: | 185? |
| Density: | 0.86 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.42 |
| Solubility: | Insoluble |
| Appearance: | Black powder. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Flash Point: | 185? |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. |
| Usage: | Flavoring. |
| Safety Data |
| |
 |
