| Identification |
| Name: | 1,4-Benzodioxan-6-amine |
| Synonyms: | 6-Amino-1,4-benzodioxane~1,4-Benzodioxan-6-amine; 1,4-benzodioxan-6-ylamine; 3,4-Ethylenedioxyaniline; 6-Amino-1,4-benzodioxan; 2,3-Dihydro-1,4-benzodioxin-6-amine; 6-Amino-1,4-benzodioxane; LABOTEST-BB LT00012696; AKOS AUF02030; AKOS BBS-00000780; 3,4-ETHYLENDIOXYANILINE |
| CAS: | 22013-33-8 |
| EINECS: | 244-718-4 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2810 |
| Density: | 1.231 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5977-1.5997 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble in water |
| Appearance: | brown to black viscous liquid after melting |
| Packinggroup: | III |
| HS Code: | 29329995 |
| Storage Temperature: | Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
