| Identification | |
| Name: | Ethanone,1-(2-pyrazinyl)- |
| Synonyms: | Ethanone,1-pyrazinyl- (9CI);Ketone, methyl pyrazinyl (6CI,8CI);1-(2-Pyrazinyl)-1-ethanone;1-(Pyrazin-2-yl)ethanone;2-Acetylpyrazine;NSC 72374;Pyrazine methyl ketone; |
| CAS: | 22047-25-2 |
| EINECS: | 244-753-5 |
| Molecular Formula: | C6H6N2O |
| Molecular Weight: | 122.13 |
| InChI: | InChI=1/C6H6N2O/c1-5(9)6-4-7-2-3-8-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 84.4 oC |
| Boiling Point: | 212.9 oC at 760 mmHg |
| Density: | 1.136 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.518 |
| Appearance: | Light yellow to yellow-brownish powder |
| Specification: |
?2-Acetylpyrazine (CAS NO.22047-25-2), its Synonyms are 1-Pyrazinylethanone ; Ethanone, 1-pyrazinyl- ; Acetylpyrazine ; Ketone, methyl pyrazinyl ; Methyl pyrazinyl ketone ; Ethanone, 1-(2-pyrazinyl)- ; Pyrazin-1-ylethan-1-one . |
| Flash Point: | 84.4 oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
