| Identification | |
| Name: | Methane-d3,sulfinylbis- (9CI) |
| Synonyms: | (Methylsulfoxide)-d6 (6CI,7CI,8CI); Bis(trideuteriomethyl) sulfoxide;Bis(trideuteromethyl) sulfoxide; DMSO-d6; Deuterated-DMSO; Di(methyl-d3)sulfoxide; Dimethyl sulfoxide-d6; Dimethyl-d6 sulfoxide; Hexadeuteriodimethylsulfoxide; Perdeuterated dimethylsulfoxide; Perdeuteriodimethyl sulfoxide;Sulfinylbis(methane-d3) |
| CAS: | 2206-27-1 |
| EINECS: | 218-617-0 |
| Molecular Formula: | C2D6 O S |
| Molecular Weight: | 84.16 |
| InChI: | InChI=1/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.19 |
| Stability: | Stable. Combustible. Moisture sensitive. Incompatible with acid chlorides, strong acids, phosphorus halides, strong oxidizing agents, strong reducing agents. Reacts violently with a wide range of materials - consult a full MSDS sheet before starting use. |
| Refractive index: | n20/D 1.476(lit.) |
| Solubility: |
|
| Appearance: | liquid |
| Storage Temperature: | Flammables area |
| Sensitive: | Hygroscopic |
| Color: | Practically colorless liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
