| Identification | |
| Name: | Molinate (1H-Azepine-1-carbothioic acid, hexahydro-S-ethyl ester) |
| Synonyms: | Ethyl1-hexamethyleneiminecarbothiolate; Felan; Hydram; Jalan; Molinate; Ordram; R4572; S-Ethyl N,N-hexamethylenethiocarbamate; S-Ethylhexahydro-1H-azepine-1-carbothioate; S-Ethyl hexahydroazepine-1-carbothioate;SC 9908; Stauffer R 4572; Yalan; Yulan |
| CAS: | 2212-67-1 |
| EINECS: | 218-661-0 |
| Molecular Formula: | C9H17 N O S |
| Molecular Weight: | 187.302 |
| InChI: | InChI=1S/C9H17NOS/c1-2-12-9(11)10-7-5-3-4-6-8-10/h2-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2902 |
| Flash Point: | 122.6°C |
| Density: | 1.06 |
| Stability: | Stable at 100 C for 16 hours apparently indefinite storage life under ambient conditions; photosensitivity is indeterminant relatively stable to hydrolysis by acids and alkalies. Stable @ < 200 C. |
| Refractive index: | 1.5092 (25 C) |
| Water Solubility: | 0.08 g/100 mL |
| Solubility: | 0.08 g/100 mL |
| Appearance: | Clear liquid with aromatic odor. |
| Specification: |
Molinate (2212-67-1) is standard solution, and also can be called Jalan ; Ordram ; S-Ethyl-1-azepancarbothioat ; S-Ethyl 1-azepanecarbothioate . |
| Packinggroup: | III |
| Flash Point: | 122.6°C |
| Storage Temperature: | 0-6°C |
| Color: | Clear liquid Amber liquid |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
T,N,Xn:
|
 |
|
