| Identification | |
| Name: | 2,3-Dichloroquinoxaline |
| Synonyms: | 2,3-Dichloroquinoxaline;NSC 33437 |
| CAS: | 2213-63-0 |
| EINECS: | 218-667-3 |
| Molecular Formula: | C8H4Cl2N2 |
| Molecular Weight: | 199.04 |
| InChI: | InChI=1/C8H4Cl2N2/c9-7-8(10)12-6-4-2-1-3-5(6)11-7/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 142.9°C |
| Boiling Point: | 269.7°Cat760mmHg |
| Density: | 1.486g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.671 |
| Solubility: | Insoluble |
| Appearance: | Gray solid. |
| Specification: |
2,3-Dichloroquinoxaline (2213-63-0) is an off-white to light brown solid and stable under normal temperatures and pressures. It should Store in a cool, dry place with a tightly closed container. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 142.9°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
