| Identification | |
| Name: | 4,4'-Oxybisbenzoic acid |
| Synonyms: | Benzoicacid, 4,4'-oxydi- (6CI,7CI,8CI);Benzoic acid, p,p'-oxybis- (3CI);Benzoicacid, p,p'-oxydi- (4CI);4,4'-Dicarboxydiphenyl ether;4,4'-Dicarboxydiphenyloxide;4,4'-Oxybis(benzoic acid);4,4'-Oxydiphenylenedicarboxylic acid;4-(4-Carboxyphenoxy)benzoic acid;Diphenyl ether-4,4'-dicarboxylic acid;NSC 39046; |
| CAS: | 2215-89-6 |
| EINECS: | 218-683-0 |
| Molecular Formula: | C14H10O5 |
| Molecular Weight: | 258.23 |
| InChI: | InChI=1/C14H10O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.395 g/cm3 |
| Refractive index: | 1.638 |
| Appearance: | white crystal powder |
| Specification: |
?4,4'-Oxybisbenzoic acid , its cas register number is 2215-89-6. It also can be called Benzoic acid, 4,4'-oxybis- ; 4-(4-Carboxyphenoxy)benzoic acid .It is a white to pale brown solid. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
