| Identification | |
| Name: | Benzenemethanol,4-methyl-, 1-acetate |
| Synonyms: | NSC 7001;p-Acetoxymethyltoluene;p-Methylbenzylacetate;p-Tolubenzyl acetate;Benzenemethanol,4-methyl-, acetate (9CI);Benzyl alcohol, p-methyl-, acetate (6CI,7CI,8CI);p-Xylyl acetate; |
| CAS: | 2216-45-7 |
| EINECS: | 218-689-3 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.21 |
| InChI: | InChI=1/C10H12O2/c1-8-3-5-10(6-4-8)7-12-9(2)11/h3-6H,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.03 |
| Refractive index: | 1.501 |
| Appearance: | Colorless liquid |
| Specification: |
4-Methylbenzyl acetate (2216-45-7) also can be called 4-Methylbenzenemethanol acetate ; p-Xylene, alpha-acetoxy ; p-Methylbenzyl alcohol acetate ; p-Xylyl acetate and p-Methylbenzyl acetate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
