Identification |
Name: | Benzenemethanol,4-methyl-, 1-acetate |
Synonyms: | NSC 7001;p-Acetoxymethyltoluene;p-Methylbenzylacetate;p-Tolubenzyl acetate;Benzenemethanol,4-methyl-, acetate (9CI);Benzyl alcohol, p-methyl-, acetate (6CI,7CI,8CI);p-Xylyl acetate; |
CAS: | 2216-45-7 |
EINECS: | 218-689-3 |
Molecular Formula: | C10H12O2 |
Molecular Weight: | 164.21 |
InChI: | InChI=1/C10H12O2/c1-8-3-5-10(6-4-8)7-12-9(2)11/h3-6H,7H2,1-2H3 |
Molecular Structure: |
|
Properties |
Density: | 1.03 |
Refractive index: | 1.501 |
Appearance: | Colorless liquid |
Specification: |
4-Methylbenzyl acetate (2216-45-7) also can be called 4-Methylbenzenemethanol acetate ; p-Xylene, alpha-acetoxy ; p-Methylbenzyl alcohol acetate ; p-Xylyl acetate and p-Methylbenzyl acetate .
|
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
|
|