| Identification | |
| Name: | Naphthalene, 1-methoxy- |
| Synonyms: | 1-Naphthol methyl ether;1-Naphthyl methyl ether;Methyl 1-naphthyl ether;NSC5530;a-Methoxynaphthalene;a-Naphthyl methyl ether; |
| CAS: | 2216-69-5 |
| EINECS: | 218-696-1 |
| Molecular Formula: | C11H10O |
| Molecular Weight: | 158.2 |
| InChI: | InChI=1/C11H10O/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.09 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.621-1.623 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | colorless to light yellow transparent liquid |
| Specification: |
Naphthalene, 1-methoxy- , its cas register number is 2216-69-5. It also can be called 1-Methoxynaphthalene ; Methyl 1-naphthyl ether ; alpha-Methoxynaphthalene ; alpha-Naphthyl methyl ether .It is a clear light yellow to brown liquid. |
| HS Code: | 29093090 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
