| Identification | |
| Name: | 1-Naphthalenamine,5,6,7,8-tetrahydro- |
| Synonyms: | 1-Naphthylamine,5,6,7,8-tetrahydro- (7CI,8CI);1,2,3,4-Tetrahydro-5-naphthalenamine;1,2,3,4-Tetrahydro-5-naphthylamine;1-Amino-5,6,7,8-tetrahydronaphthalene;5,6,7,8-Tetrahydro-1-naphthalenamine;5,6,7,8-Tetrahydro-1-naphthalenylamine;5-Amino-1,2,3,4-tetrahydronaphthalene;5-Aminotetralin;5-Tetralinylamine;NSC 53503; |
| CAS: | 2217-41-6 |
| EINECS: | 218-713-2 |
| Molecular Formula: | C10H13N |
| Molecular Weight: | 147.22 |
| InChI: | InChI=1/C10H13N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,1-2,4,6,11H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.06 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.590 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Dark red to brown liquid. Aromatic odor. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
