| Identification | |
| Name: | Benzene,1,3-dimethoxy-5-[(1E)-2-(4-methoxyphenyl)ethenyl]- |
| Synonyms: | Benzene,1,3-dimethoxy-5-[2-(4-methoxyphenyl)ethenyl]-, (E)-;Stilbene,3,4',5-trimethoxy-, (E)- (8CI);(E)-1,3-Dimethoxy-5-(4-methoxystyryl)benzene;(E)-1-(4-Methoxyphenyl)-2-(3,5-dimethoxyphenyl)ethene;(E)-2-(3,5-Dimethoxyphenyl)-1-(4-methoxyphenyl)ethene;(E)-3,4',5-Trimethoxystilbene;(E)-3,5,4'-Trimethoxystilbene;3,4',5-Trimethoxy-trans-stilbene;3,5,4'-Trimethoxy-trans-stilbene;Resveratroltrimethyl ether;Tri-O-methylresveratrol; |
| CAS: | 22255-22-7 |
| Molecular Formula: | C17H18O3 |
| Molecular Weight: | 270.32 |
| InChI: | InChI=1/C17H18O3/c1-18-15-8-6-13(7-9-15)4-5-14-10-16(19-2)12-17(11-14)20-3/h4-12H,1-3H3/b5-4+ |
| Molecular Structure: | ![(C17H18O3) Benzene,1,3-dimethoxy-5-[2-(4-methoxyphenyl)ethenyl]-, (E)-;Stilbene,3,4',5-trimethoxy-, (E)- (8CI);...](https://img1.guidechem.com/chem/e/dict/26/22255-22-7.jpg) |
| Properties | |
| Melting Point: | 57°C |
| Flash Point: | 144.4°C |
| Boiling Point: | 423.8°C at 760 mmHg |
| Density: | 1.104g/cm3 |
| Refractive index: | 1.599 |
| Appearance: | Pale yellow oil |
| Flash Point: | 144.4°C |
| Usage: | A resveratrol analog with a variety of pharmacology action, including anti-cancer properties, anti-allergic activity, estrogenic activity, antiangiogenic activity, and vascular-targeting activity against microtubule-destabilization |
| Safety Data | |
 |
|
