| Identification | |
| Name: | 1,3-Dioxolane-4-methanol,2,2-dimethyl-, (4S)- |
| Synonyms: | 1,3-Dioxolane-4-methanol,2,2-dimethyl-, (S)-;1,3-Dioxolane-4-methanol, 2,2-dimethyl-, L- (8CI);((4S)-2,2-Dimethyl-1,3-dioxolan-4-yl)methanol;(+)-1,2-O-Isopropylidene-sn-glycerol;(+)-2,2-Dimethyl-1,3-dioxolane-4-methanol;(+)-Glycerol acetonide;(+)-Solketal;(+)-a,b-Isopropylideneglycerol;(2S)-Glycerol 1,2-acetonide;(4S)-2,2-Dimethyl-1,3-dioxolan-4-ylmethanol;(S)-(+)-(2,2-Dimethyl-[1,3]dioxolan-4-yl)methanol;(S)-(+)-1,2-Isopropylideneglycerol;(S)-(+)-2,2-Dimethyl-1,3-dioxolan-4-methanol;(S)-1,2-Isopropylideneglycerol;(S)-1,2-O-Isopropylideneglycerol;(S)-2,2-Dimethyl-1,3-dioxolan-4-methanol;(S)-Isopropylideneglycerol;(S)-Solketal;1,2-O-Isopropylidene-(S)-glycerol;2,3-O-Isopropylidene-D-glycerol;S-Glycerol acetonide; |
| CAS: | 22323-82-6 |
| EINECS: | 244-910-8 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.07 |
| Stability: | Stable. Flammable. Incompatible with oxidizing agents. |
| Refractive index: | 1.433-1.435 |
| Alpha: | 11 o (C=5, CH3OH) |
| Water Solubility: | miscible |
| Solubility: | miscible in water |
| Appearance: | White to off white crystal |
| HS Code: | 29329970 |
| Usage: | A MEK inhibitor with antitumor activity |
| Safety Data | |
 |
|
