| Identification |
| Name: | benzoic acid, compound with dicyclohexylamine (1:1) |
| Synonyms: | Benzoic acid, compd. with N-cyclohexylcyclohexanamine (1:1);Benzoic acid dicyclohexylamine salt;Dicyclohexylamine benzoate;Dicyclohexylammonium benzoate;Benzoic acid, compd. with dicyclohexylamine (1:1) (8CI);Benzoic acid, compound with dicyclohexylamine (1:1);Dicyclohexylamine, compd. with benzoic acid (7CI);N-cyclohexylcyclohexanamine benzoate (1:1) |
| CAS: | 22355-34-6 |
| EINECS: | 244-932-8 |
| Molecular Formula: | C19H29NO2 |
| Molecular Weight: | 303.4391 |
| InChI: | InChI=1/C12H23N.C7H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h11-13H,1-10H2;1-5H,(H,8,9) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 96.1°C |
| Boiling Point: | 256.1°C at 760 mmHg |
| Flash Point: | 96.1°C |
| Safety Data |
| |
 |
