| Identification | |
| Name: | 3-Aminobenzonitrile |
| Synonyms: | Benzonitrile,m-amino- (6CI,7CI,8CI);Benzonitrile, 3-amino-;3-Cyanoaniline;3-Cyanophenylamine;NSC 7626;m-Aminobenzonitrile;m-Cyanoaniline; |
| CAS: | 2237-30-1 |
| EINECS: | 218-800-5 |
| Molecular Formula: | C7H6N2 |
| Molecular Weight: | 118.14 |
| InChI: | InChI=1/C7H6N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.14 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | brown crystalline solid |
| Specification: |
?3-Aminobenzonitrile (CAS NO.2237-30-1) is also named as 3-Cyanoaniline ; 4-14-00-01095 (Beilstein Handbook Reference) ; BRN 0636498 ; NSC 7626 ; m-Aminobenzonitrile ; m-Anthranilonitrile ; m-Cyanoaniline?; Benzonitrile, 3-amino- (9CI) ; Benzonitrile, m-amino-?.?3-Aminobenzonitrile (CAS NO.2237-30-1) is brown crystalline solid. It is toxic. It is flammable by fire. It will produce toxic?nitrile and nitrogen oxide gas?by heat. So the storage environment should be ventilate, low-temperature and dry. Keep?3-Aminobenzonitrile separate from?food, oxidant and acid. |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
