| Identification | |
| Name: | 3-Amino-1-phenylbutane |
| Synonyms: | Propylamine,1-methyl-3-phenyl- (6CI,7CI,8CI);(3-Aminobutyl)benzene;(RS)-1-Methyl-3-phenylpropylamine;1-Methyl-3-phenylpropylamine;1-Phenyl-3-aminobutane;2-Amino-4-phenylbutane;4-Phenyl-2-aminobutane;4-Phenyl-2-butanamine;DL-1-Methyl-3-phenylpropylamine;NSC 115524;a-Methylbenzenepropanamine; |
| CAS: | 22374-89-6 |
| EINECS: | 244-942-2 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.26 |
| InChI: | InChI=1/C10H15N/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9H,7-8,11H2,1H3/p+1/t9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 8/PG 3 |
| Density: | 0.936 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5126-1.5146 |
| Water Solubility: | 8.5 G/L (20 ºC) |
| Appearance: | colorless liquid |
| Specification: |
3-Amino-1-phenylbutane , its CAS NO. is 22374-89-6, the synonyms are 4-Phenyl-2-butylamine ; 4-Phenyl-2-aminobutane ;1-Phenyl-3-aminobutane ; 1-Methyl-3-phenylpropylamine ; Benzenepropanamine, .alpha.-methyl- ; 1-Phenyl-3-Amino-butan ; alpha-Methylbenzenepropanamine . |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | −20°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
Xi: Irritant
T: Toxic
F: Flammable
|
 |
|
