| Identification | |
| Name: | Aminoacetaldehyde dimethyl acetal |
| Synonyms: | 2,2-Dimethoxyethylamine; 2,2-Dimethyethanamine |
| CAS: | 22483-09-6 |
| EINECS: | 245-026-5 |
| Molecular Formula: | C4H11NO2 |
| Molecular Weight: | 105.14 |
| InChI: | InChI=1/C4H11NO2/c1-6-4(3-5)7-2/h4H,3,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | -78 |
| Density: | 0.965 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.416-1.418 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | clear, colourless to slightly yellowish liquid |
| Specification: |
?2,2-Dimethoxyethylamine , its CAS NO. is 22483-09-6, the synonyms are?Acetaldehyde,amino-, dimethyl acetal (6CI,8CI) ; Ethylamine, 2,2-dimethoxy- (8CI) ; 1-Amino-2,2-dimethoxyethane ; 2,2-Dimethoxyethanamine . |
| Packinggroup: | III |
| HS Code: | 29225000 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
