| Identification | |
| Name: | 1-(4-Fluorophenyl)piperazine |
| Synonyms: | 4-(1-Piperazino)fluorobenzene; 1-(fluorophenyl)piperazine |
| CAS: | 2252-63-3 |
| EINECS: | 218-846-6 |
| Molecular Formula: | C10H13FN2 |
| Molecular Weight: | 180.22 |
| InChI: | InChI=1/C10H13FN2/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1-4,12H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.0 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5585-1.5605 |
| Solubility: | Very soluble |
| Appearance: | clear yellowish liquid after melting |
| Specification: |
? 4-Fluoro-phenylpiperazine , with CAS number of 2252-63-3, can be called piperazine, 1-(4-fluorophenyl)- ; 1-(4-Fluorophenyl)piperazine ; 1-(p-Fluorophenyl)piperazine ; 1-(4-fluorophenyl)piperazine hydrochloride ; 1-(4-Fluorophenyl)piperazine 97% . It is a?clear yellowish liquid after melting. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
