Identification |
Name: | Ethanone,1-benzo[b]thien-2-yl- |
Synonyms: | Ketone,benzo[b]thien-2-yl methyl (7CI,8CI);1-(Benzo[b]thiophen-2-yl)ethan-1-one;1-Benzo[b]thiophen-2-ylethanone;2-Acetylbenzothiophene; |
CAS: | 22720-75-8 |
EINECS: | 245-177-7 |
Molecular Formula: | C10H8OS |
Molecular Weight: | 176.23 |
InChI: | InChI=1/C10H8OS/c1-7(11)10-6-8-4-2-3-5-9(8)12-10/h2-6H,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 86-88ºC |
Flash Point: | 138 ºC |
Boiling Point: | 304.5 ºCat 760 mmHg |
Density: | 1.219 g/cm3 |
Refractive index: | 1.646 |
Appearance: | white to light yellow crystal powder |
Flash Point: | 138 ºC |
Usage: | A novel anti-osteoporosis agent, by enhansing expression of the BMP-2 gene. |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|