Identification |
Name: | Carbonic acid, thio-,anhydrosulfide with (3,4-diethoxyphenethyl)dithiocarbamic acid, ethyl ester(8CI) |
Synonyms: | Carbonic acid, thio-, anhydrosulfide with (3,4-diethoxyphenethyl)dithiocarbamic acid, ethyl ester;Thiocarbonic acid anhydrosulfide with (3,4-diethoxyphenethyl)dithiocarbamic acid ethyl ester;AC1MHUQ5;LS-52113;ethyl 2-(3,4-diethoxyphenyl)ethylcarbamothioylsulfanylformate;22739-10-2 |
CAS: | 22739-10-2 |
Molecular Formula: | C16H23 N O4 S2 |
Molecular Weight: | 357.4881 |
InChI: | InChI=1/C16H23NO4S2/c1-4-19-13-8-7-12(11-14(13)20-5-2)9-10-17-15(22)23-16(18)21-6-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,17,22) |
Molecular Structure: |
|
Properties |
Flash Point: | 237.3°C |
Boiling Point: | 468.7°C at 760 mmHg |
Density: | 1.189g/cm3 |
Refractive index: | 1.563 |
Flash Point: | 237.3°C |
Safety Data |
|
|