Boc-L-methionine dicyclohexylamine salt (22823-50-3)

The Boc-L-methionine dicyclohexylamine salt with the cas number 22823-50-3 is also called BOC-MET-OH DCHA. The systematic name is N-(tert-butoxycarbonyl)-L-methionine - N-cyclohexylcyclohexanamine (1:1). Its EINECS registry number is 245-251-9. The molecular formula is C₁₂H₂₃N^.C₁₀H₁₉NO₄S. This chemical belongs to the following product categories: (1)Methionine [Met, M]; (2)Boc-Amino Acids and Derivative.

The properties of the chemical are: (1)ACD/LogP: 2.15; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.04; (4)ACD/LogD (pH 7.4): -1.41; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 2.74; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 81.14 Å²; (13)Enthalpy of Vaporization: 73.34 kJ/mol; (14)Vapour Pressure: 4.56×10^-8 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OC(C)(C)C)N[C@H](C(=O)O)CCSC.N(C1CCCCC1)C2CCCCC2
(2)InChI: InChI=1/C12H23N.C10H19NO4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-10(2,3)15-9(14)11-7(8(12)13)5-6-16-4/h11-13H,1-10H2;7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t;7-/m.0/s1
(3)InChIKey: SKDIPRMGDVUUQO-ZLTKDMPEBW