| Identification | |
| Name: | 2-hydroxy-1-naphthoic acid |
| Synonyms: | - |
| CAS: | 2283-08-1 |
| EINECS: | 218-919-2 |
| Molecular Formula: | C11H8O3 |
| Molecular Weight: | 188.18 |
| InChI: | InChI=1/C11H8O3/c12-9-6-5-7-3-1-2-4-8(7)10(9)11(13)14/h1-6,12H,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 212.1°C |
| Boiling Point: | 403.6°Cat760mmHg |
| Density: | 1.399g/cm3 |
| Refractive index: | 1.716 |
| Specification: |
2-Hydroxy-1-naphthoic acid with CAS registry number of 2283-08-1 is also known as 2-Hydroxy-1-naphthoic acid ; AI3-19839 ; NSC 2803 ; 1-Naphthalenecarboxylic acid, 2-hydroxy- ; 1-Naphthoic acid, 2-hydroxy- (8CI) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Flash Point: | 212.1°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
