| Identification | |
| Name: | Pyridine,2-bromo-3-methyl-5-nitro- |
| Synonyms: | 3-Picoline,2-bromo-5-nitro- (8CI);2-Bromo-3-methyl-5-nitropyridine;6-Bromo-5-methyl-3-nitropyridine; |
| CAS: | 23132-21-0 |
| Molecular Formula: | C6H5BrN2O2 |
| Molecular Weight: | 217.02 |
| InChI: | InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 57-58°C |
| Flash Point: | 138.3°C |
| Boiling Point: | 305.1°Cat760mmHg |
| Density: | 1.709g/cm3 |
| Refractive index: | 1.599 |
| Specification: |
2-Bromo-3-methyl-5-nitropyridine with cas registry number of 23132-21-0 is also known as Pyridine, 2-bromo-3-methyl-5-nitro- ; 2-Bromo-5-nitro-3-picoline . It is a compound with the appearance of yellow solid which should be stored in a cool, dry place and kept away from oxidizing agents when not in use. 2-Bromo-3-methyl-5-nitropyridine with cas registry number of 23132-21-0 is used as a pharmaceutical intermediate . |
| Flash Point: | 138.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
