| Identification | |
| Name: | 4-Piperidinone,1-propyl- |
| Synonyms: | 4-Piperidone,1-propyl- (8CI);1-Propyl-4-piperidinone;1-n-Propyl-4-piperidone;N-Propyl-4-piperidinone; |
| CAS: | 23133-37-1 |
| EINECS: | 245-444-8 |
| Molecular Formula: | C8H15NO |
| Molecular Weight: | 141.21 |
| InChI: | InChI=1/C8H15NO/c1-2-5-9-6-3-8(10)4-7-9/h2-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.936 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.46-1.462 |
| Appearance: | Clear yellow liquid. |
| Specification: |
1-Propylpiperidin-4-on , with CAS number of 23133-37-1, can be called 4-piperidinone, 1-propyl- ; 1-Propylpiperidin-4-one ; 1-Propyl-4-piperidinone ; 1-Propyl-piperidin-4-one ; n-Propyl-4-piperidone . It is a clear yellow liquid. |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
