| Identification |
| Name: | 3,4-Dimethoxycinnamic acid |
| Synonyms: | 3,4-Dimethoxyphenyl-2-propenoic acid;2-Propenoic acid, 3-(3,4-dimethoxyphenyl)-;Cinnamic acid, 3,4-dimethoxy-;2-Propenoic acid, 3- (3,4-dimethoxyphenyl)-;3-(3,4-Dimethoxyphenyl)propenoic acid;Caffeic acid dimethyl ether;Cinnamic acid, 3,4-dimethoxy- (8CI); |
| CAS: | 2316-26-9 |
| EINECS: | 219-025-5 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.21 |
| InChI: | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Melting Point: | 181- 183 oC |
| Flash Point: | 144 oC |
| Boiling Point: | 367.4 oCat 760 mmHg |
| Density: | 1.203 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | yellow to beige crystals |
| Flash Point: | 144 oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
