| Identification | |
| Name: | Benzoic acid, 4-amino-,ethyl ester, hydrochloride (1:1) |
| Synonyms: | Benzoicacid, 4-amino-, ethyl ester, hydrochloride (9CI);Benzoic acid, p-amino-, ethylester, hydrochloride (8CI);4-(Ethoxycarbonyl)anilinium chloride;Amben ethylester hydrochloride;Ethyl p-aminobenzoatehydrochloride; |
| CAS: | 23239-88-5 |
| Molecular Formula: | C9H11NO2.HCl |
| Molecular Weight: | 201.65 |
| InChI: | InChI=1/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 208ºC |
| Flash Point: | 228.6°C |
| Boiling Point: | 495°Cat760mmHg |
| Density: | 1.286g/cm3 |
| Solubility: | One gram dissolves in about 5 ml alcohol, 2 ml chloroform, in about 4 ml ether, and in 30 to 50 ml of expressed almond oil or olive oil. Also sol in dil acids. Soluble in acid In water, 1,310 mg/L at 25 deg C |
| Appearance: | hite crystalline powder |
| Flash Point: | 228.6°C |
| Color: | Rhombohedra from ether Needles from water |
| Safety Data | |
 |
|
