| Identification | |
| Name: | 1-Naphthalenecarboxylicacid, 1,2,3,4-tetrahydro-, (1R)- |
| Synonyms: | 1-Naphthalenecarboxylicacid, 1,2,3,4-tetrahydro-, (R)-;1-Naphthoic acid, 1,2,3,4-tetrahydro-,(R)-(+)- (8CI); |
| CAS: | 23357-47-3 |
| Molecular Formula: | C11H12O2 |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C11H12O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2,(H,12,13)/t10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 156.4°C |
| Boiling Point: | 342.7°Cat760mmHg |
| Density: | 1.186g/cm3 |
| Refractive index: | 1.576 |
| Specification: |
(R)-1,2,3,4-Tetrahedro-naphthoic acid ,its cas register number is 23357-47-3. It also can be called (1R)-1,2,3,4-Tetrahydronaphthalene-1-carboxylic acid ; 1-Naphthalenecarboxylic acid, 1,2,3,4-tetrahydro-, (1R)- and (1R)-1,2,3,4-Tetrahydro-1-naphthalenecarboxylic acid . |
| Flash Point: | 156.4°C |
| Safety Data | |
 |
|
