| Identification |
| Name: | 5-Aza-2'-deoxycytidine |
| Synonyms: | s-Triazin-2(1H)-one,4-amino-1-(2-deoxy-b-D-erythro-pentofuranosyl)-(7CI,8CI);2-Desoxy-5-azacytidine;2'-Deoxy-5-azacytidine;5-Azadeoxycytidine;DAC;Dacogen;1,3,5-Triazin-2(1H)-one,4-amino-1-(2-deoxy-b-D-erythro-pentofuranosyl)-;b-Decitabine; |
| CAS: | 2353-33-5 |
| EINECS: | 219-089-4 |
| Molecular Formula: | C8H12N4O4 |
| Molecular Weight: | 228.20528 |
| InChI: | InChI=1S/C8H12N4O4/c9-7-10-3-12(8(15)11-7)6-1-4(14)5(2-13)16-6/h3-6,13-14H,1-2H2,(H2,9,11,15)/t4-,5+,6+/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.9 g/cm3 |
| Stability: | Stable. May be light or air sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.779 |
| Water Solubility: | acetic acid/water (1:1): 50 mg/mL |
| Solubility: | acetic acid/water (1:1): 50 mg/mL |
| Appearance: | white crystalline powder |
| Specification: |
? Decitabine (CAS NO.2353-33-5), its Synonyms are 5-Aza-2'-deoxycytidine ; 2-Desoxy-5-azacytidine ; 2-deoxyazacytidine ; 4-Amino-1-(2-deoxy-beta-D-erythro-pentofuranosyl)-s-triazin-2(1H)-one ; 5-Azadeoxycytidine ; 1,3,5-Triazin-2(1H)-one, 4-amino-1-(2-deoxy-beta-D-erythro-pentofuranosyl)- . It is white crystalline powder.
|
| Biological Activity: | Cytosine analog that once incorporated into DNA acts as a suicide substrate for DNA methyltransferase. Inhibits DNA methyltransferase and results in DNA hypomethylation and activation of silent genes. Chemotherapeutic agent; suppresses growth of human tumor cell lines. Demethylates differentiation-related genes; reverses embryonic stem cell differentiation. |
| Usage: | Decitabine (CAS NO.2353-33-5) is used as a drug. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |