| Identification | |
| Name: | Thiophanate-Methyl |
| Synonyms: | thiophanate methyl; 1,2-bis(3-(methoxycarbonyl)-2-thioureido)benzene; dimethyl (1,2-phenylenebis(iminocarbonothioyl))bis(carbamate); Thiophanate methyl W.P.; 1,2-di(3-methoxycarbonyl-2-thioureido)benzene; Caswell No. 375A; Cercobin methyl |
| CAS: | 23564-05-8 |
| EINECS: | 245-740-7 |
| Molecular Formula: | C12H14N4O4S2 |
| Molecular Weight: | 342.39 |
| InChI: | InChI=1/C12H14N4O4S2/c1-19-11(17)15-9(21)13-7-5-3-4-6-8(7)14-10(22)16-12(18)20-2/h3-6H,1-2H3,(H2,13,15,17,21)(H2,14,16,18,22) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.495g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, alkalies, copper salts. |
| Refractive index: | 1.734 |
| Appearance: | colourless crystals, or white or light brown powder |
| Specification: |
STORAGE of Thiophanate-methyl (CAS NO.23564-05-8) : Do not store in a manner where cross-contamination with other pesticides, fertilizers, food or feed could occur.? Store in the original container in a dry, temperature controlled area. |
| Usage: | Fungicide. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
