| Identification | |
| Name: | Benzoic acid,4-bromo-3-nitro-, methyl ester |
| Synonyms: | 4-Bromo-3-nitrobenzoicacid methyl ester;4-Bromo-3-nitrobenzoic acid methyl ester; |
| CAS: | 2363-16-8 |
| Molecular Formula: | C8H6BrNO4 |
| Molecular Weight: | 260.04 |
| InChI: | InChI=1/C8H6BrNO4/c1-14-8(11)5-2-3-6(9)7(4-5)10(12)13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 102-103oC |
| Density: | 1.673 g/cm3 |
| Refractive index: | 1.587 |
| Appearance: | colorless crystals |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
