| Identification | |
| Name: | Benzo[c]phenanthrene,3-methyl- |
| Synonyms: | 3-Methyl-3,4-benzophenanthrene;3-Methylbenzo[c]phenanthrene; NSC 97698 |
| CAS: | 2381-19-3 |
| Molecular Formula: | C19H14 |
| Molecular Weight: | 242.33 |
| InChI: | InChI=1S/C19H14/c1-13-6-11-18-16(12-13)10-9-15-8-7-14-4-2-3-5-17(14)19(15)18/h2-12H,1H3 |
| Molecular Structure: | ![(C19H14) 3-Methyl-3,4-benzophenanthrene;3-Methylbenzo[c]phenanthrene; NSC 97698](https://img1.guidechem.com/chem/e/dict/38/2381-19-3.jpg) |
| Properties | |
| Flash Point: | 217.8°C |
| Boiling Point: | 449.4°Cat760mmHg |
| Density: | 1.164g/cm3 |
| Specification: |
7-Methyl-3,4-benzphenanthrene ,with CAS number of 2381-19-3,can be called 3-Methyl-3,4-benzophenanthrene ; 3-Methylbenzo(c)phenanthrene ; BRN 2328896 ; NSC 97698 and so on. |
| Flash Point: | 217.8°C |
| Safety Data | |
 |
|
