| Identification | |
| Name: | carbocistein |
| Synonyms: | Mucodyne |
| CAS: | 2387-59-9 |
| EINECS: | 246-934-4 |
| Molecular Formula: | C5H9NO4S |
| Molecular Weight: | 179.19 |
| InChI: | InChI=1/C5H9NO4S/c6-3(5(9)10)1-11-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 208-213 oC (dec.) |
| Flash Point: | 206.2 oC |
| Boiling Point: | 417.3 oC at 760 mmHg |
| Density: | 1.514 g/cm3 |
| Appearance: | Carbocysteine occurs as a white crystalline powder |
| Specification: |
S-(Carboxymethyl)cysteine , its cas register number 2387-59-9. It also can be called Carbocistein ; Mucodyne ; and S-Carboxymethyl-L-cysteine . |
| Flash Point: | 206.2 oC |
| Safety Data | |
 |
|
