| Identification | |
| Name: | 4-Methoxybenzylamine |
| Synonyms: | p-anisylamine; (4-methoxyphenyl)methanamine |
| CAS: | 2393-23-9 |
| EINECS: | 219-247-2 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 1.05 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.546-1.548 |
| Solubility: | Very soluble |
| Appearance: | clear colorless to slightly yellow liquid |
| Specification: |
4-methoxybenzylamine , with CAS number of 2393-23-9, can be called (4-Methoxyphenyl)methanamine ; 1-(4-Methoxyphenyl)methanamine ; 1-Aminomethyl-4-methoxybenzene ; 4-Methoxybenzylamine ; 4-Methoxyphenylmethylamine ; Anisylamine ; p-Methoxybenzylamine . It is a clear colorless to slightly yellow liquid. For the synthesis of pharmaceutical intermediates. |
| Packinggroup: | III |
| HS Code: | 29222900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
