| Identification | |
| Name: | VMA |
| Synonyms: | 4-Hydroxy-3-methoxymandelic acid; DL-4-Hydroxy-3-methoxymandelic acid; DL-Vanillomandelic acid; DL-3-Methoxy-4-hydroxymandelic acid DL-4-Hydroxy-3-methoxy mandelic acid |
| CAS: | 2394-20-9 |
| EINECS: | 200-224-0 |
| Molecular Formula: | C9H10O5 |
| Molecular Weight: | 198.17 |
| InChI: | InChI=1/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 173.7°C |
| Boiling Point: | 421.3°C at 760 mmHg |
| Density: | 1.44g/cm3 |
| Refractive index: | 1.606 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 173.7°C |
| Storage Temperature: | 2-8°C |
| Color: | white to off-white |
| Safety Data | |
 |
|
