| Identification | |
| Name: | 3-Hexenoic acid, ethylester |
| Synonyms: | Hydrosorbicacid, ethyl ester (6CI); Ethyl 3-hexenoate |
| CAS: | 2396-83-0 |
| EINECS: | 219-257-7 |
| Molecular Formula: | C8H14 O2 |
| Molecular Weight: | 142.2 |
| InChI: | InChI=1/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h5-6H,3-4,7H2,1-2H3/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Melting Point: | -56 |
| Flash Point: | 139? |
| Density: | 0.896 |
| Stability: | Decomposition will not occur if used and stored according to specifications. |
| Refractive index: | 1.426 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid |
| Specification: |
Ethyl 3-hexenoate (CAS No.2396-83-0), its synonyms are 3-hexenoic acid, ethyl ester ; 3-Hexenoic acid, ethyl ester, (3E)- ; 3-Hexenoic acid, ethyl ester, (E)- ; Ethyl (3E)-hex-3-enoate ; Ethyl (E)-3-hexenoate ; Ethyl hex-3-enoate . |
| Packinggroup: | III |
| Flash Point: | 139? |
| Storage Temperature: | Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. |
| Safety Data | |
 |
|
