| Identification |
| Name: | 2-ethyl-4-methyl-1H-imidazole-1-propiononitrile |
| Synonyms: | Imidazole-1-propionitrile,2-ethyl-4-methyl- (8CI); 1-(2-Cyanoethyl)-2-ethyl-4-methylimidazole;1-(Cyanethyl)-2-ethyl-4-methylimidazole;1-Cyanoethyl-2-ethyl-4-methylimidazole; 2E4MZ-CN; Curezol 2E4MZ-CN; Curimid CN;Epicure EM 24CN |
| CAS: | 23996-25-0 |
| EINECS: | 245-975-5 |
| Molecular Formula: | C9H13N3 |
| Molecular Weight: | 163.22 |
| InChI: | InChI=1/C9H13N3/c1-3-9-11-8(2)7-12(9)6-4-5-10/h7H,3-4,6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Melting Point: | 61-66ºC |
| Density: | 0.95 |
| Refractive index: | 1.5070 |
| Water Solubility: | soluble in water, alcohol, propanone and benzene |
| Solubility: | soluble in water, alcohol, propanone and benzene |
| Appearance: | white or light yellow crystal |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
