| Identification |
| Name: | 2-Pyridinamine,3-(phenylmethoxy)- |
| Synonyms: | Pyridine,2-amino-3-(benzyloxy)- (8CI);2-Amino-3-(benzoxy)pyridine;3-(Phenylmethoxy)-2-pyridinamine;3-Benzyloxy-2-aminopyridine;NSC 298538;[(3-(Benzyloxy)pyridin-2-yl])amine; |
| CAS: | 24016-03-3 |
| EINECS: | 245-983-9 |
| Molecular Formula: | C12H12N2O |
| Molecular Weight: | 200.24 |
| InChI: | InChI=1/C12H12N2O/c13-12-11(7-4-8-14-12)15-9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,13,14) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2811 |
| Flash Point: | 172.6°C |
| Boiling Point: | 342 |
| Density: | 1.18 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | white to yellowish crystal |
| Flash Point: | 172.6°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
