Identification |
Name: | 2-Pyridinamine,3-(phenylmethoxy)- |
Synonyms: | Pyridine,2-amino-3-(benzyloxy)- (8CI);2-Amino-3-(benzoxy)pyridine;3-(Phenylmethoxy)-2-pyridinamine;3-Benzyloxy-2-aminopyridine;NSC 298538;[(3-(Benzyloxy)pyridin-2-yl])amine; |
CAS: | 24016-03-3 |
EINECS: | 245-983-9 |
Molecular Formula: | C12H12N2O |
Molecular Weight: | 200.24 |
InChI: | InChI=1/C12H12N2O/c13-12-11(7-4-8-14-12)15-9-10-5-2-1-3-6-10/h1-8H,9H2,(H2,13,14) |
Molecular Structure: |
 |
Properties |
Transport: | UN2811 |
Flash Point: | 172.6°C |
Boiling Point: | 342 |
Density: | 1.18 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Water Solubility: | SOLVENT |
Solubility: | SOLVENT |
Appearance: | white to yellowish crystal |
Flash Point: | 172.6°C |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
|
|
 |