| Identification | |
| Name: | 6-Benzothiazolamine,2-chloro- |
| Synonyms: | Benzothiazole,6-amino-2-chloro- (6CI,7CI,8CI);2-Chloro-6-aminobenzothiazole;6-Amino-2-chlorobenzothiazole; |
| CAS: | 2406-90-8 |
| Molecular Formula: | C7H5ClN2S |
| Molecular Weight: | 184.65 |
| InChI: | InChI=1/C7H5ClN2S/c8-7-10-5-2-1-4(9)3-6(5)11-7/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 155-157 ºC |
| Density: | 1.532 |
| Refractive index: | 1.763 |
| Specification: |
The cas register number of 2-Chlorobenzothiazo-6-amine is 2406-90-8. It also can be called as 6-Amino-2-chlorobenzothiazole and the Systematic name about this chemical is 2-chloro-1,3-benzothiazol-6-amine. It belongs to the Benzothiazole. Physical properties about 2-Chlorobenzothiazo-6-amine are: (1)ACD/LogP: 1.67; (2)ACD/LogD (pH 5.5): 2; (3)ACD/LogD (pH 7.4): 2; (4)ACD/BCF (pH 5.5): 25; (5)ACD/BCF (pH 7.4): 25; (6)ACD/KOC (pH 5.5): 344; (7)ACD/KOC (pH 7.4): 344; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 67.15Å2; (12)Index of Refraction: 1.763; (13)Molar Refractivity: 49.702 cm3; (14)Molar Volume: 120.483 cm3; (15)Polarizability: 19.703x10-24cm3; (16)Surface Tension: 71.308 dyne/cm; (17)Enthalpy of Vaporization: 58.053 kJ/mol. Preparation: this chemical can be prepared by 6-azido-2-chloro-benzothiazole. This reaction will need reagent 3M potassium methoxide and solvent dioxane, methanol. The yield is about 33 %. Uses of 2-Chlorobenzothiazo-6-amine: it can be used to produce N-(2-chloro-benzothiazol-6-yl)anthranilic acid with 2-bromo-benzoic acid. This reaction will need reagent K2CO3, Cu, KI and solvent butan-2-one with reaction time of 2 hours. The yield is about 76%. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
